C22H21NO4S — CID 94833356
methyl (4Z)-1-(3-methoxyphenyl)-2-methyl-4-[(4-methylsulfanylphenyl)methylidene]-5-oxopyrrole-3-carboxylate (PubChem CID 94833356) has the molecular formula C22H21NO4S and a molecular weight of 395.48 g/mol. Its IUPAC name is methyl (4Z)-1-(3-methoxyphenyl)-2-methyl-4-[(4-methylsulfanylphenyl)methylidene]-5-oxopyrrole-3-carboxylate.
| Compound Name | methyl (4Z)-1-(3-methoxyphenyl)-2-methyl-4-[(4-methylsulfanylphenyl)methylidene]-5-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 94833356 |
| Molecular Formula | C22H21NO4S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | methyl (4Z)-1-(3-methoxyphenyl)-2-methyl-4-[(4-methylsulfanylphenyl)methylidene]-5-oxopyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2cccc(OC)c2)C(=O)/C1=C\c1ccc(SC)cc1 |
| InChI | InChI=1S/C22H21NO4S/c1-14-20(22(25)27-3)19(12-15-8-10-18(28-4)11-9-15)21(24)23(14)16-6-5-7-17(13-16)26-2/h5-13H,1-4H3/b19-12- |
| InChIKey | RRYFDVIAZZQPCO-UNOMPAQXSA-N |
| XLogP | 4.29 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|