C23H25NO5 — CID 9483404
3-(5-phenylfuran-2-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]propanamide (PubChem CID 9483404) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is 3-(5-phenylfuran-2-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]propanamide.
| Compound Name | 3-(5-phenylfuran-2-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 9483404 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 3-(5-phenylfuran-2-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]propanamide |
| SMILES | COc1cc(CNC(=O)CCc2ccc(-c3ccccc3)o2)cc(OC)c1OC |
| InChI | InChI=1S/C23H25NO5/c1-26-20-13-16(14-21(27-2)23(20)28-3)15-24-22(25)12-10-18-9-11-19(29-18)17-7-5-4-6-8-17/h4-9,11,13-14H,10,12,15H2,1-3H3,(H,24,25) |
| InChIKey | ILEAVMSWHUQUTI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |