C21H20ClN5O2 — CID 94836720
N'-[(Z)-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-(pyridin-4-ylmethyl)oxamide (PubChem CID 94836720) has the molecular formula C21H20ClN5O2 and a molecular weight of 409.88 g/mol. Its IUPAC name is N'-[(Z)-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-(pyridin-4-ylmethyl)oxamide.
| Compound Name | N'-[(Z)-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-(pyridin-4-ylmethyl)oxamide |
|---|---|
| PubChem CID | 94836720 |
| Molecular Formula | C21H20ClN5O2 |
| Molecular Weight | 409.88 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | N'-[(Z)-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-(pyridin-4-ylmethyl)oxamide |
| SMILES | Cc1cc(/C=N\NC(=O)C(=O)NCc2ccncc2)c(C)n1-c1ccccc1Cl |
| InChI | InChI=1S/C21H20ClN5O2/c1-14-11-17(15(2)27(14)19-6-4-3-5-18(19)22)13-25-26-21(29)20(28)24-12-16-7-9-23-10-8-16/h3-11,13H,12H2,1-2H3,(H,24,28)(H,26,29)/b25-13- |
| InChIKey | JGKITWJWKIFTNX-MXAYSNPKSA-N |
| XLogP | 2.91 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.88 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|