C16H18Cl2N4O2 — CID 9483843
2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[[4-(dimethylamino)phenyl]methyl]-N-methylacetamide (PubChem CID 9483843) has the molecular formula C16H18Cl2N4O2 and a molecular weight of 369.25 g/mol. Its IUPAC name is 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[[4-(dimethylamino)phenyl]methyl]-N-methylacetamide.
| Compound Name | 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[[4-(dimethylamino)phenyl]methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 9483843 |
| Molecular Formula | C16H18Cl2N4O2 |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[[4-(dimethylamino)phenyl]methyl]-N-methylacetamide |
| SMILES | CN(Cc1ccc(N(C)C)cc1)C(=O)Cn1ncc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C16H18Cl2N4O2/c1-20(2)12-6-4-11(5-7-12)9-21(3)14(23)10-22-16(24)15(18)13(17)8-19-22/h4-8H,9-10H2,1-3H3 |
| InChIKey | FUXANNZJTLNZGA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|