(2R)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanoic acid

C6H8N2O3S — CID 9484224

IUPAC(2R)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanoic acid
SMILESCc1nnc(S[C@H](C)C(=O)O)o1
InChIInChI=1S/C6H8N2O3S/c1-3(5(9)10)12-6-8-7-4(2)11-6/h3H,1-2H3,(H,9,10)/t3-/m1/s1
InChIKeyAYPASJTYLYDBIU-GSVOUGTGSA-N
MW188.21 g/mol
LogP0.94
Rot. Bonds3

About (2R)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanoic acid

(2R)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanoic acid (PubChem CID 9484224) has the molecular formula C6H8N2O3S and a molecular weight of 188.21 g/mol. Its IUPAC name is (2R)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanoic acid.

Molecular Properties

Compound Name(2R)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanoic acid
PubChem CID9484224
Molecular FormulaC6H8N2O3S
Molecular Weight188.21 g/mol
Exact Mass188.03
IUPAC Name(2R)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanoic acid
SMILESCc1nnc(S[C@H](C)C(=O)O)o1
InChIInChI=1S/C6H8N2O3S/c1-3(5(9)10)12-6-8-7-4(2)11-6/h3H,1-2H3,(H,9,10)/t3-/m1/s1
InChIKeyAYPASJTYLYDBIU-GSVOUGTGSA-N
XLogP0.94
TPSA76.22 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.21
LogP ≤ 50.94
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze (2R)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanoic acid?
The IUPAC name of (2R)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanoic acid (CID 9484224) is (2R)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanoic acid.
What is the SMILES notation for (2R)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanoic acid?
The canonical SMILES for (2R)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanoic acid is Cc1nnc(S[C@H](C)C(=O)O)o1.
What is the InChIKey of (2R)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanoic acid?
The InChIKey is AYPASJTYLYDBIU-GSVOUGTGSA-N. The full InChI is InChI=1S/C6H8N2O3S/c1-3(5(9)10)12-6-8-7-4(2)11-6/h3H,1-2H3,(H,9,10)/t3-/m1/s1.
What are the key properties of (2R)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanoic acid?
(2R)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanoic acid has a molecular weight of 188.21 g/mol, XLogP of 0.94, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanoic acid is sourced from PubChem (CID 9484224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).