About 3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanoate
3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanoate (PubChem CID 9484298) has the molecular formula C8H10NO3S-
and a molecular weight of 200.24 g/mol. Its IUPAC name is 3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanoate.
Molecular Properties
| Compound Name | 3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanoate |
| PubChem CID | 9484298 |
| Molecular Formula | C8H10NO3S- |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanoate |
| SMILES | Cc1nc(SCCC(=O)[O-])oc1C |
| InChI | InChI=1S/C8H11NO3S/c1-5-6(2)12-8(9-5)13-4-3-7(10)11/h3-4H2,1-2H3,(H,10,11)/p-1 |
| InChIKey | NIAHNJWALRMITM-UHFFFAOYSA-M |
| XLogP | 0.52 |
| TPSA | 66.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanoate?
The IUPAC name of 3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanoate (CID 9484298) is 3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanoate.
What is the SMILES notation for 3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanoate?
The canonical SMILES for 3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanoate is Cc1nc(SCCC(=O)[O-])oc1C.
What is the InChIKey of 3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanoate?
The InChIKey is NIAHNJWALRMITM-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H11NO3S/c1-5-6(2)12-8(9-5)13-4-3-7(10)11/h3-4H2,1-2H3,(H,10,11)/p-1.
What are the key properties of 3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanoate?
3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanoate has a molecular weight of 200.24 g/mol, XLogP of 0.52, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanoate is sourced from PubChem (CID 9484298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).