C19H22ClNO2 — CID 94843604
(2R)-2-(2-chlorophenoxy)-N-[(1R)-1-(2,5-dimethylphenyl)ethyl]propanamide (PubChem CID 94843604) has the molecular formula C19H22ClNO2 and a molecular weight of 331.84 g/mol. Its IUPAC name is (2R)-2-(2-chlorophenoxy)-N-[(1R)-1-(2,5-dimethylphenyl)ethyl]propanamide.
| Compound Name | (2R)-2-(2-chlorophenoxy)-N-[(1R)-1-(2,5-dimethylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 94843604 |
| Molecular Formula | C19H22ClNO2 |
| Molecular Weight | 331.84 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | (2R)-2-(2-chlorophenoxy)-N-[(1R)-1-(2,5-dimethylphenyl)ethyl]propanamide |
| SMILES | Cc1ccc(C)c([C@@H](C)NC(=O)[C@@H](C)Oc2ccccc2Cl)c1 |
| InChI | InChI=1S/C19H22ClNO2/c1-12-9-10-13(2)16(11-12)14(3)21-19(22)15(4)23-18-8-6-5-7-17(18)20/h5-11,14-15H,1-4H3,(H,21,22)/t14-,15-/m1/s1 |
| InChIKey | YUGVQAGPFAIUBO-HUUCEWRRSA-N |
| XLogP | 4.60 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.84 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |