C32H31N3OS — CID 94845501
(5E)-3-benzyl-2-benzylimino-5-[[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 94845501) has the molecular formula C32H31N3OS and a molecular weight of 505.69 g/mol. Its IUPAC name is (5E)-3-benzyl-2-benzylimino-5-[[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-benzyl-2-benzylimino-5-[[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 94845501 |
| Molecular Formula | C32H31N3OS |
| Molecular Weight | 505.69 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | (5E)-3-benzyl-2-benzylimino-5-[[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(C)cc(-n2c(C)cc(/C=C3/S/C(=N\Cc4ccccc4)N(Cc4ccccc4)C3=O)c2C)c1 |
| InChI | InChI=1S/C32H31N3OS/c1-22-15-23(2)17-29(16-22)35-24(3)18-28(25(35)4)19-30-31(36)34(21-27-13-9-6-10-14-27)32(37-30)33-20-26-11-7-5-8-12-26/h5-19H,20-21H2,1-4H3/b30-19+,33-32- |
| InChIKey | JJUBQGHYZJABHH-NWIQEISKSA-N |
| XLogP | 7.38 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.69 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|