C25H27NO4 — CID 94845804
methyl (4Z)-2-methyl-1-(2-methylpropyl)-5-oxo-4-[(2-phenylmethoxyphenyl)methylidene]pyrrole-3-carboxylate (PubChem CID 94845804) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is methyl (4Z)-2-methyl-1-(2-methylpropyl)-5-oxo-4-[(2-phenylmethoxyphenyl)methylidene]pyrrole-3-carboxylate.
| Compound Name | methyl (4Z)-2-methyl-1-(2-methylpropyl)-5-oxo-4-[(2-phenylmethoxyphenyl)methylidene]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 94845804 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | methyl (4Z)-2-methyl-1-(2-methylpropyl)-5-oxo-4-[(2-phenylmethoxyphenyl)methylidene]pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(CC(C)C)C(=O)/C1=C\c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C25H27NO4/c1-17(2)15-26-18(3)23(25(28)29-4)21(24(26)27)14-20-12-8-9-13-22(20)30-16-19-10-6-5-7-11-19/h5-14,17H,15-16H2,1-4H3/b21-14- |
| InChIKey | PYDHPLDZUGDVST-STZFKDTASA-N |
| XLogP | 4.59 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|