About [(2R)-1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]propan-2-yl] 4-bromobenzoate
[(2R)-1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]propan-2-yl] 4-bromobenzoate (PubChem CID 94848253) has the molecular formula C21H22BrN3O4S
and a molecular weight of 492.40 g/mol. Its IUPAC name is [(2R)-1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]propan-2-yl] 4-bromobenzoate.
Molecular Properties
| Compound Name | [(2R)-1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]propan-2-yl] 4-bromobenzoate |
| PubChem CID | 94848253 |
| Molecular Formula | C21H22BrN3O4S |
| Molecular Weight | 492.40 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | [(2R)-1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]propan-2-yl] 4-bromobenzoate |
| SMILES | C[C@H](CN1CCN(C2=NS(=O)(=O)c3ccccc32)CC1)OC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H22BrN3O4S/c1-15(29-21(26)16-6-8-17(22)9-7-16)14-24-10-12-25(13-11-24)20-18-4-2-3-5-19(18)30(27,28)23-20/h2-9,15H,10-14H2,1H3/t15-/m1/s1 |
| InChIKey | NCVACKLFLZOJSH-OAHLLOKOSA-N |
| XLogP | 2.76 |
| TPSA | 79.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 492.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(2R)-1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]propan-2-yl] 4-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]propan-2-yl] 4-bromobenzoate?
The IUPAC name of [(2R)-1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]propan-2-yl] 4-bromobenzoate (CID 94848253) is [(2R)-1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]propan-2-yl] 4-bromobenzoate.
What is the SMILES notation for [(2R)-1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]propan-2-yl] 4-bromobenzoate?
The canonical SMILES for [(2R)-1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]propan-2-yl] 4-bromobenzoate is C[C@H](CN1CCN(C2=NS(=O)(=O)c3ccccc32)CC1)OC(=O)c1ccc(Br)cc1.
What is the InChIKey of [(2R)-1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]propan-2-yl] 4-bromobenzoate?
The InChIKey is NCVACKLFLZOJSH-OAHLLOKOSA-N. The full InChI is InChI=1S/C21H22BrN3O4S/c1-15(29-21(26)16-6-8-17(22)9-7-16)14-24-10-12-25(13-11-24)20-18-4-2-3-5-19(18)30(27,28)23-20/h2-9,15H,10-14H2,1H3/t15-/m1/s1.
What are the key properties of [(2R)-1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]propan-2-yl] 4-bromobenzoate?
[(2R)-1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]propan-2-yl] 4-bromobenzoate has a molecular weight of 492.40 g/mol, XLogP of 2.76, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]propan-2-yl] 4-bromobenzoate is sourced from PubChem (CID 94848253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).