C17H15Cl2N3O — CID 948485
(1S)-2-(3-chlorophenyl)-1-(4-chlorophenyl)-1,5,6,7-tetrahydropyrazolo[1,2-a][1,2,4]triazol-3-one (PubChem CID 948485) has the molecular formula C17H15Cl2N3O and a molecular weight of 348.23 g/mol. Its IUPAC name is (1S)-2-(3-chlorophenyl)-1-(4-chlorophenyl)-1,5,6,7-tetrahydropyrazolo[1,2-a][1,2,4]triazol-3-one.
| Compound Name | (1S)-2-(3-chlorophenyl)-1-(4-chlorophenyl)-1,5,6,7-tetrahydropyrazolo[1,2-a][1,2,4]triazol-3-one |
|---|---|
| PubChem CID | 948485 |
| Molecular Formula | C17H15Cl2N3O |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | (1S)-2-(3-chlorophenyl)-1-(4-chlorophenyl)-1,5,6,7-tetrahydropyrazolo[1,2-a][1,2,4]triazol-3-one |
| SMILES | O=C1N(c2cccc(Cl)c2)[C@H](c2ccc(Cl)cc2)N2CCCN12 |
| InChI | InChI=1S/C17H15Cl2N3O/c18-13-7-5-12(6-8-13)16-20-9-2-10-21(20)17(23)22(16)15-4-1-3-14(19)11-15/h1,3-8,11,16H,2,9-10H2/t16-/m1/s1 |
| InChIKey | CQOBLKLDYYWEQP-MRXNPFEDSA-N |
| XLogP | 4.55 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |