About (3S)-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-ol
(3S)-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-ol (PubChem CID 94848528) has the molecular formula C8H8O3S
and a molecular weight of 184.22 g/mol. Its IUPAC name is (3S)-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-ol.
Molecular Properties
| Compound Name | (3S)-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-ol |
| PubChem CID | 94848528 |
| Molecular Formula | C8H8O3S |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.02 |
| IUPAC Name | (3S)-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-ol |
| SMILES | O=S1(=O)C[C@@H](O)c2ccccc21 |
| InChI | InChI=1S/C8H8O3S/c9-7-5-12(10,11)8-4-2-1-3-6(7)8/h1-4,7,9H,5H2/t7-/m1/s1 |
| InChIKey | RVSZMOUZQCRNKH-SSDOTTSWSA-N |
| XLogP | 0.51 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-ol?
The IUPAC name of (3S)-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-ol (CID 94848528) is (3S)-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-ol.
What is the SMILES notation for (3S)-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-ol?
The canonical SMILES for (3S)-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-ol is O=S1(=O)C[C@@H](O)c2ccccc21.
What is the InChIKey of (3S)-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-ol?
The InChIKey is RVSZMOUZQCRNKH-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H8O3S/c9-7-5-12(10,11)8-4-2-1-3-6(7)8/h1-4,7,9H,5H2/t7-/m1/s1.
What are the key properties of (3S)-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-ol?
(3S)-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-ol has a molecular weight of 184.22 g/mol, XLogP of 0.51, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-ol is sourced from PubChem (CID 94848528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).