C27H26BrNO7 — CID 94854402
[(2S)-oxolan-2-yl]methyl (4R,7R)-4-(6-bromo-1,3-benzodioxol-5-yl)-7-(furan-2-yl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 94854402) has the molecular formula C27H26BrNO7 and a molecular weight of 556.41 g/mol. Its IUPAC name is [(2S)-oxolan-2-yl]methyl (4R,7R)-4-(6-bromo-1,3-benzodioxol-5-yl)-7-(furan-2-yl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | [(2S)-oxolan-2-yl]methyl (4R,7R)-4-(6-bromo-1,3-benzodioxol-5-yl)-7-(furan-2-yl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 94854402 |
| Molecular Formula | C27H26BrNO7 |
| Molecular Weight | 556.41 g/mol |
| Exact Mass | 555.09 |
| IUPAC Name | [(2S)-oxolan-2-yl]methyl (4R,7R)-4-(6-bromo-1,3-benzodioxol-5-yl)-7-(furan-2-yl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CC1=C(C(=O)OC[C@@H]2CCCO2)[C@H](c2cc3c(cc2Br)OCO3)C2=C(C[C@@H](c3ccco3)CC2=O)N1 |
| InChI | InChI=1S/C27H26BrNO7/c1-14-24(27(31)34-12-16-4-2-6-32-16)25(17-10-22-23(11-18(17)28)36-13-35-22)26-19(29-14)8-15(9-20(26)30)21-5-3-7-33-21/h3,5,7,10-11,15-16,25,29H,2,4,6,8-9,12-13H2,1H3/t15-,16+,25+/m1/s1 |
| InChIKey | VZGMIIWVUDSPCS-TWKFVSLJSA-N |
| XLogP | 4.85 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.41 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |