C16H13NO4S2 — CID 94855713
(6S,7S)-7-(4-methylphenyl)spiro[5,7-dihydro-3H-thiopyrano[2,3-d][1,3]thiazole-6,3'-oxolane]-2,2',5'-trione (PubChem CID 94855713) has the molecular formula C16H13NO4S2 and a molecular weight of 347.42 g/mol. Its IUPAC name is (6S,7S)-7-(4-methylphenyl)spiro[5,7-dihydro-3H-thiopyrano[2,3-d][1,3]thiazole-6,3'-oxolane]-2,2',5'-trione.
| Compound Name | (6S,7S)-7-(4-methylphenyl)spiro[5,7-dihydro-3H-thiopyrano[2,3-d][1,3]thiazole-6,3'-oxolane]-2,2',5'-trione |
|---|---|
| PubChem CID | 94855713 |
| Molecular Formula | C16H13NO4S2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | (6S,7S)-7-(4-methylphenyl)spiro[5,7-dihydro-3H-thiopyrano[2,3-d][1,3]thiazole-6,3'-oxolane]-2,2',5'-trione |
| SMILES | Cc1ccc([C@@H]2c3sc(=O)[nH]c3SC[C@@]23CC(=O)OC3=O)cc1 |
| InChI | InChI=1S/C16H13NO4S2/c1-8-2-4-9(5-3-8)11-12-13(17-15(20)23-12)22-7-16(11)6-10(18)21-14(16)19/h2-5,11H,6-7H2,1H3,(H,17,20)/t11-,16+/m1/s1 |
| InChIKey | WKZWARGPGUQSOL-BZNIZROVSA-N |
| XLogP | 2.44 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|