C26H29BrN2O3S — CID 94863973
2-(3-bromo-N-(4-methylphenyl)sulfonylanilino)-N-[(1R)-3-methyl-1-phenylbutyl]acetamide (PubChem CID 94863973) has the molecular formula C26H29BrN2O3S and a molecular weight of 529.50 g/mol. Its IUPAC name is 2-(3-bromo-N-(4-methylphenyl)sulfonylanilino)-N-[(1R)-3-methyl-1-phenylbutyl]acetamide.
| Compound Name | 2-(3-bromo-N-(4-methylphenyl)sulfonylanilino)-N-[(1R)-3-methyl-1-phenylbutyl]acetamide |
|---|---|
| PubChem CID | 94863973 |
| Molecular Formula | C26H29BrN2O3S |
| Molecular Weight | 529.50 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | 2-(3-bromo-N-(4-methylphenyl)sulfonylanilino)-N-[(1R)-3-methyl-1-phenylbutyl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)N[C@H](CC(C)C)c2ccccc2)c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C26H29BrN2O3S/c1-19(2)16-25(21-8-5-4-6-9-21)28-26(30)18-29(23-11-7-10-22(27)17-23)33(31,32)24-14-12-20(3)13-15-24/h4-15,17,19,25H,16,18H2,1-3H3,(H,28,30)/t25-/m1/s1 |
| InChIKey | NCTLKPWJFVMGRD-RUZDIDTESA-N |
| XLogP | 5.86 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.50 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |