About (2R)-2-(3-cyano-1,2,4-triazol-1-yl)butanoic acid
(2R)-2-(3-cyano-1,2,4-triazol-1-yl)butanoic acid (PubChem CID 94864644) has the molecular formula C7H8N4O2
and a molecular weight of 180.17 g/mol. Its IUPAC name is (2R)-2-(3-cyano-1,2,4-triazol-1-yl)butanoic acid.
Molecular Properties
| Compound Name | (2R)-2-(3-cyano-1,2,4-triazol-1-yl)butanoic acid |
| PubChem CID | 94864644 |
| Molecular Formula | C7H8N4O2 |
| Molecular Weight | 180.17 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | (2R)-2-(3-cyano-1,2,4-triazol-1-yl)butanoic acid |
| SMILES | CC[C@H](C(=O)O)n1cnc(C#N)n1 |
| InChI | InChI=1S/C7H8N4O2/c1-2-5(7(12)13)11-4-9-6(3-8)10-11/h4-5H,2H2,1H3,(H,12,13)/t5-/m1/s1 |
| InChIKey | AGMJUQOUQIJLIL-RXMQYKEDSA-N |
| XLogP | 0.19 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.17 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-2-(3-cyano-1,2,4-triazol-1-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(3-cyano-1,2,4-triazol-1-yl)butanoic acid?
The IUPAC name of (2R)-2-(3-cyano-1,2,4-triazol-1-yl)butanoic acid (CID 94864644) is (2R)-2-(3-cyano-1,2,4-triazol-1-yl)butanoic acid.
What is the SMILES notation for (2R)-2-(3-cyano-1,2,4-triazol-1-yl)butanoic acid?
The canonical SMILES for (2R)-2-(3-cyano-1,2,4-triazol-1-yl)butanoic acid is CC[C@H](C(=O)O)n1cnc(C#N)n1.
What is the InChIKey of (2R)-2-(3-cyano-1,2,4-triazol-1-yl)butanoic acid?
The InChIKey is AGMJUQOUQIJLIL-RXMQYKEDSA-N. The full InChI is InChI=1S/C7H8N4O2/c1-2-5(7(12)13)11-4-9-6(3-8)10-11/h4-5H,2H2,1H3,(H,12,13)/t5-/m1/s1.
What are the key properties of (2R)-2-(3-cyano-1,2,4-triazol-1-yl)butanoic acid?
(2R)-2-(3-cyano-1,2,4-triazol-1-yl)butanoic acid has a molecular weight of 180.17 g/mol, XLogP of 0.19, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(3-cyano-1,2,4-triazol-1-yl)butanoic acid is sourced from PubChem (CID 94864644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).