C6H8F6O3 — CID 94865854
(1R)-3,3,3-trifluoro-1-[(1R)-3,3,3-trifluoro-1-hydroxypropoxy]propan-1-ol (PubChem CID 94865854) has the molecular formula C6H8F6O3 and a molecular weight of 242.12 g/mol. Its IUPAC name is (1R)-3,3,3-trifluoro-1-[(1R)-3,3,3-trifluoro-1-hydroxypropoxy]propan-1-ol.
| Compound Name | (1R)-3,3,3-trifluoro-1-[(1R)-3,3,3-trifluoro-1-hydroxypropoxy]propan-1-ol |
|---|---|
| PubChem CID | 94865854 |
| Molecular Formula | C6H8F6O3 |
| Molecular Weight | 242.12 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | (1R)-3,3,3-trifluoro-1-[(1R)-3,3,3-trifluoro-1-hydroxypropoxy]propan-1-ol |
| SMILES | O[C@@H](CC(F)(F)F)O[C@@H](O)CC(F)(F)F |
| InChI | InChI=1S/C6H8F6O3/c7-5(8,9)1-3(13)15-4(14)2-6(10,11)12/h3-4,13-14H,1-2H2/t3-,4-/m1/s1 |
| InChIKey | MBQFJCIIFZJMTG-QWWZWVQMSA-N |
| XLogP | 1.54 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.12 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|