C21H25N5O — CID 94867369
1-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-3-[(1R)-4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl]urea (PubChem CID 94867369) has the molecular formula C21H25N5O and a molecular weight of 363.47 g/mol. Its IUPAC name is 1-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-3-[(1R)-4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl]urea.
| Compound Name | 1-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-3-[(1R)-4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl]urea |
|---|---|
| PubChem CID | 94867369 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 1-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-3-[(1R)-4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl]urea |
| SMILES | CC1(C)CC[C@@H](NC(=O)NCCNc2ncccc2C#N)c2ccccc21 |
| InChI | InChI=1S/C21H25N5O/c1-21(2)10-9-18(16-7-3-4-8-17(16)21)26-20(27)25-13-12-24-19-15(14-22)6-5-11-23-19/h3-8,11,18H,9-10,12-13H2,1-2H3,(H,23,24)(H2,25,26,27)/t18-/m1/s1 |
| InChIKey | AFXCXAJTWBVIFL-GOSISDBHSA-N |
| XLogP | 3.48 |
| TPSA | 89.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|