C19H24N2S — CID 94870483
(2R)-2-(naphthalen-1-ylmethyl)-N-propan-2-ylpyrrolidine-1-carbothioamide (PubChem CID 94870483) has the molecular formula C19H24N2S and a molecular weight of 312.48 g/mol. Its IUPAC name is (2R)-2-(naphthalen-1-ylmethyl)-N-propan-2-ylpyrrolidine-1-carbothioamide.
| Compound Name | (2R)-2-(naphthalen-1-ylmethyl)-N-propan-2-ylpyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 94870483 |
| Molecular Formula | C19H24N2S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | (2R)-2-(naphthalen-1-ylmethyl)-N-propan-2-ylpyrrolidine-1-carbothioamide |
| SMILES | CC(C)NC(=S)N1CCC[C@@H]1Cc1cccc2ccccc12 |
| InChI | InChI=1S/C19H24N2S/c1-14(2)20-19(22)21-12-6-10-17(21)13-16-9-5-8-15-7-3-4-11-18(15)16/h3-5,7-9,11,14,17H,6,10,12-13H2,1-2H3,(H,20,22)/t17-/m1/s1 |
| InChIKey | ZBSQFSAQAZLKQV-QGZVFWFLSA-N |
| XLogP | 4.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|