About [(3S,5R)-5-methyl-2-oxooxolan-3-yl] 2-[4-(1,3-dithian-2-yl)phenoxy]acetate
[(3S,5R)-5-methyl-2-oxooxolan-3-yl] 2-[4-(1,3-dithian-2-yl)phenoxy]acetate (PubChem CID 94871521) has the molecular formula C17H20O5S2
and a molecular weight of 368.48 g/mol. Its IUPAC name is [(3S,5R)-5-methyl-2-oxooxolan-3-yl] 2-[4-(1,3-dithian-2-yl)phenoxy]acetate.
Molecular Properties
| Compound Name | [(3S,5R)-5-methyl-2-oxooxolan-3-yl] 2-[4-(1,3-dithian-2-yl)phenoxy]acetate |
| PubChem CID | 94871521 |
| Molecular Formula | C17H20O5S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | [(3S,5R)-5-methyl-2-oxooxolan-3-yl] 2-[4-(1,3-dithian-2-yl)phenoxy]acetate |
| SMILES | C[C@@H]1C[C@H](OC(=O)COc2ccc(C3SCCCS3)cc2)C(=O)O1 |
| InChI | InChI=1S/C17H20O5S2/c1-11-9-14(16(19)21-11)22-15(18)10-20-13-5-3-12(4-6-13)17-23-7-2-8-24-17/h3-6,11,14,17H,2,7-10H2,1H3/t11-,14+/m1/s1 |
| InChIKey | BDNCJOVDIYTBQI-RISCZKNCSA-N |
| XLogP | 3.18 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [(3S,5R)-5-methyl-2-oxooxolan-3-yl] 2-[4-(1,3-dithian-2-yl)phenoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,5R)-5-methyl-2-oxooxolan-3-yl] 2-[4-(1,3-dithian-2-yl)phenoxy]acetate?
The IUPAC name of [(3S,5R)-5-methyl-2-oxooxolan-3-yl] 2-[4-(1,3-dithian-2-yl)phenoxy]acetate (CID 94871521) is [(3S,5R)-5-methyl-2-oxooxolan-3-yl] 2-[4-(1,3-dithian-2-yl)phenoxy]acetate.
What is the SMILES notation for [(3S,5R)-5-methyl-2-oxooxolan-3-yl] 2-[4-(1,3-dithian-2-yl)phenoxy]acetate?
The canonical SMILES for [(3S,5R)-5-methyl-2-oxooxolan-3-yl] 2-[4-(1,3-dithian-2-yl)phenoxy]acetate is C[C@@H]1C[C@H](OC(=O)COc2ccc(C3SCCCS3)cc2)C(=O)O1.
What is the InChIKey of [(3S,5R)-5-methyl-2-oxooxolan-3-yl] 2-[4-(1,3-dithian-2-yl)phenoxy]acetate?
The InChIKey is BDNCJOVDIYTBQI-RISCZKNCSA-N. The full InChI is InChI=1S/C17H20O5S2/c1-11-9-14(16(19)21-11)22-15(18)10-20-13-5-3-12(4-6-13)17-23-7-2-8-24-17/h3-6,11,14,17H,2,7-10H2,1H3/t11-,14+/m1/s1.
What are the key properties of [(3S,5R)-5-methyl-2-oxooxolan-3-yl] 2-[4-(1,3-dithian-2-yl)phenoxy]acetate?
[(3S,5R)-5-methyl-2-oxooxolan-3-yl] 2-[4-(1,3-dithian-2-yl)phenoxy]acetate has a molecular weight of 368.48 g/mol, XLogP of 3.18, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,5R)-5-methyl-2-oxooxolan-3-yl] 2-[4-(1,3-dithian-2-yl)phenoxy]acetate is sourced from PubChem (CID 94871521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).