About 2-[(3S)-1,1-dioxothiolan-3-yl]-1-(4-pyrimidin-2-ylpiperazin-1-yl)ethanone
2-[(3S)-1,1-dioxothiolan-3-yl]-1-(4-pyrimidin-2-ylpiperazin-1-yl)ethanone (PubChem CID 94874916) has the molecular formula C14H20N4O3S
and a molecular weight of 324.41 g/mol. Its IUPAC name is 2-[(3S)-1,1-dioxothiolan-3-yl]-1-(4-pyrimidin-2-ylpiperazin-1-yl)ethanone.
Molecular Properties
| Compound Name | 2-[(3S)-1,1-dioxothiolan-3-yl]-1-(4-pyrimidin-2-ylpiperazin-1-yl)ethanone |
| PubChem CID | 94874916 |
| Molecular Formula | C14H20N4O3S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 2-[(3S)-1,1-dioxothiolan-3-yl]-1-(4-pyrimidin-2-ylpiperazin-1-yl)ethanone |
| SMILES | O=C(C[C@H]1CCS(=O)(=O)C1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C14H20N4O3S/c19-13(10-12-2-9-22(20,21)11-12)17-5-7-18(8-6-17)14-15-3-1-4-16-14/h1,3-4,12H,2,5-11H2/t12-/m1/s1 |
| InChIKey | ARDFQGMTPVKSNK-GFCCVEGCSA-N |
| XLogP | -0.05 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(3S)-1,1-dioxothiolan-3-yl]-1-(4-pyrimidin-2-ylpiperazin-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S)-1,1-dioxothiolan-3-yl]-1-(4-pyrimidin-2-ylpiperazin-1-yl)ethanone?
The IUPAC name of 2-[(3S)-1,1-dioxothiolan-3-yl]-1-(4-pyrimidin-2-ylpiperazin-1-yl)ethanone (CID 94874916) is 2-[(3S)-1,1-dioxothiolan-3-yl]-1-(4-pyrimidin-2-ylpiperazin-1-yl)ethanone.
What is the SMILES notation for 2-[(3S)-1,1-dioxothiolan-3-yl]-1-(4-pyrimidin-2-ylpiperazin-1-yl)ethanone?
The canonical SMILES for 2-[(3S)-1,1-dioxothiolan-3-yl]-1-(4-pyrimidin-2-ylpiperazin-1-yl)ethanone is O=C(C[C@H]1CCS(=O)(=O)C1)N1CCN(c2ncccn2)CC1.
What is the InChIKey of 2-[(3S)-1,1-dioxothiolan-3-yl]-1-(4-pyrimidin-2-ylpiperazin-1-yl)ethanone?
The InChIKey is ARDFQGMTPVKSNK-GFCCVEGCSA-N. The full InChI is InChI=1S/C14H20N4O3S/c19-13(10-12-2-9-22(20,21)11-12)17-5-7-18(8-6-17)14-15-3-1-4-16-14/h1,3-4,12H,2,5-11H2/t12-/m1/s1.
What are the key properties of 2-[(3S)-1,1-dioxothiolan-3-yl]-1-(4-pyrimidin-2-ylpiperazin-1-yl)ethanone?
2-[(3S)-1,1-dioxothiolan-3-yl]-1-(4-pyrimidin-2-ylpiperazin-1-yl)ethanone has a molecular weight of 324.41 g/mol, XLogP of -0.05, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S)-1,1-dioxothiolan-3-yl]-1-(4-pyrimidin-2-ylpiperazin-1-yl)ethanone is sourced from PubChem (CID 94874916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).