C20H23NO6S — CID 9487982
[2-[2-(3-methylphenoxy)ethylamino]-2-oxoethyl] 2-methyl-5-methylsulfonylbenzoate (PubChem CID 9487982) has the molecular formula C20H23NO6S and a molecular weight of 405.47 g/mol. Its IUPAC name is [2-[2-(3-methylphenoxy)ethylamino]-2-oxoethyl] 2-methyl-5-methylsulfonylbenzoate.
| Compound Name | [2-[2-(3-methylphenoxy)ethylamino]-2-oxoethyl] 2-methyl-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 9487982 |
| Molecular Formula | C20H23NO6S |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | [2-[2-(3-methylphenoxy)ethylamino]-2-oxoethyl] 2-methyl-5-methylsulfonylbenzoate |
| SMILES | Cc1cccc(OCCNC(=O)COC(=O)c2cc(S(C)(=O)=O)ccc2C)c1 |
| InChI | InChI=1S/C20H23NO6S/c1-14-5-4-6-16(11-14)26-10-9-21-19(22)13-27-20(23)18-12-17(28(3,24)25)8-7-15(18)2/h4-8,11-12H,9-10,13H2,1-3H3,(H,21,22) |
| InChIKey | ZORPZOIRZVKDIS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|