About 1-[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]-3-(4-methylphenyl)urea
1-[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]-3-(4-methylphenyl)urea (PubChem CID 948803) has the molecular formula C16H13FN4OS
and a molecular weight of 328.37 g/mol. Its IUPAC name is 1-[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]-3-(4-methylphenyl)urea.
Molecular Properties
| Compound Name | 1-[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]-3-(4-methylphenyl)urea |
| PubChem CID | 948803 |
| Molecular Formula | C16H13FN4OS |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 1-[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2nnc(-c3ccccc3F)s2)cc1 |
| InChI | InChI=1S/C16H13FN4OS/c1-10-6-8-11(9-7-10)18-15(22)19-16-21-20-14(23-16)12-4-2-3-5-13(12)17/h2-9H,1H3,(H2,18,19,21,22) |
| InChIKey | WWIISNQHOLAVGS-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]-3-(4-methylphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]-3-(4-methylphenyl)urea?
The IUPAC name of 1-[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]-3-(4-methylphenyl)urea (CID 948803) is 1-[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]-3-(4-methylphenyl)urea.
What is the SMILES notation for 1-[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]-3-(4-methylphenyl)urea?
The canonical SMILES for 1-[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]-3-(4-methylphenyl)urea is Cc1ccc(NC(=O)Nc2nnc(-c3ccccc3F)s2)cc1.
What is the InChIKey of 1-[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]-3-(4-methylphenyl)urea?
The InChIKey is WWIISNQHOLAVGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13FN4OS/c1-10-6-8-11(9-7-10)18-15(22)19-16-21-20-14(23-16)12-4-2-3-5-13(12)17/h2-9H,1H3,(H2,18,19,21,22).
What are the key properties of 1-[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]-3-(4-methylphenyl)urea?
1-[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]-3-(4-methylphenyl)urea has a molecular weight of 328.37 g/mol, XLogP of 4.30, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]-3-(4-methylphenyl)urea is sourced from PubChem (CID 948803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).