C11H24N2S — CID 94885646
N',N'-diethyl-N-[(3R)-thian-3-yl]ethane-1,2-diamine (PubChem CID 94885646) has the molecular formula C11H24N2S and a molecular weight of 216.39 g/mol. Its IUPAC name is N',N'-diethyl-N-[(3R)-thian-3-yl]ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-[(3R)-thian-3-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 94885646 |
| Molecular Formula | C11H24N2S |
| Molecular Weight | 216.39 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | N',N'-diethyl-N-[(3R)-thian-3-yl]ethane-1,2-diamine |
| SMILES | CCN(CC)CCN[C@@H]1CCCSC1 |
| InChI | InChI=1S/C11H24N2S/c1-3-13(4-2)8-7-12-11-6-5-9-14-10-11/h11-12H,3-10H2,1-2H3/t11-/m1/s1 |
| InChIKey | MWNQWMTVUCAAQP-LLVKDONJSA-N |
| XLogP | 1.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |