About 2H-imidazo[1,5-d][1,2,4]triazin-1-one
2H-imidazo[1,5-d][1,2,4]triazin-1-one (PubChem CID 948878) has the molecular formula C5H4N4O
and a molecular weight of 136.11 g/mol. Its IUPAC name is 2H-imidazo[1,5-d][1,2,4]triazin-1-one.
Molecular Properties
| Compound Name | 2H-imidazo[1,5-d][1,2,4]triazin-1-one |
| PubChem CID | 948878 |
| Molecular Formula | C5H4N4O |
| Molecular Weight | 136.11 g/mol |
| Exact Mass | 136.04 |
| IUPAC Name | 2H-imidazo[1,5-d][1,2,4]triazin-1-one |
| SMILES | O=c1[nH]ncn2cncc12 |
| InChI | InChI=1S/C5H4N4O/c10-5-4-1-6-2-9(4)3-7-8-5/h1-3H,(H,8,10) |
| InChIKey | HSXZMRQGOBACOI-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.11 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2H-imidazo[1,5-d][1,2,4]triazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-imidazo[1,5-d][1,2,4]triazin-1-one?
The IUPAC name of 2H-imidazo[1,5-d][1,2,4]triazin-1-one (CID 948878) is 2H-imidazo[1,5-d][1,2,4]triazin-1-one.
What is the SMILES notation for 2H-imidazo[1,5-d][1,2,4]triazin-1-one?
The canonical SMILES for 2H-imidazo[1,5-d][1,2,4]triazin-1-one is O=c1[nH]ncn2cncc12.
What is the InChIKey of 2H-imidazo[1,5-d][1,2,4]triazin-1-one?
The InChIKey is HSXZMRQGOBACOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4O/c10-5-4-1-6-2-9(4)3-7-8-5/h1-3H,(H,8,10).
What are the key properties of 2H-imidazo[1,5-d][1,2,4]triazin-1-one?
2H-imidazo[1,5-d][1,2,4]triazin-1-one has a molecular weight of 136.11 g/mol, XLogP of -0.58, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-imidazo[1,5-d][1,2,4]triazin-1-one is sourced from PubChem (CID 948878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).