C12H19NO2 — CID 94891967
(S)-(5-ethylfuran-2-yl)-(oxan-4-yl)methanamine (PubChem CID 94891967) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is (S)-(5-ethylfuran-2-yl)-(oxan-4-yl)methanamine.
| Compound Name | (S)-(5-ethylfuran-2-yl)-(oxan-4-yl)methanamine |
|---|---|
| PubChem CID | 94891967 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | (S)-(5-ethylfuran-2-yl)-(oxan-4-yl)methanamine |
| SMILES | CCc1ccc([C@@H](N)C2CCOCC2)o1 |
| InChI | InChI=1S/C12H19NO2/c1-2-10-3-4-11(15-10)12(13)9-5-7-14-8-6-9/h3-4,9,12H,2,5-8,13H2,1H3/t12-/m0/s1 |
| InChIKey | SPOCIDCEFGEMJV-LBPRGKRZSA-N |
| XLogP | 2.27 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |