C11H12BrNO5S — CID 94895660
4-bromo-3-[(3S)-3-hydroxypyrrolidin-1-yl]sulfonylbenzoic acid (PubChem CID 94895660) has the molecular formula C11H12BrNO5S and a molecular weight of 350.19 g/mol. Its IUPAC name is 4-bromo-3-[(3S)-3-hydroxypyrrolidin-1-yl]sulfonylbenzoic acid.
| Compound Name | 4-bromo-3-[(3S)-3-hydroxypyrrolidin-1-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 94895660 |
| Molecular Formula | C11H12BrNO5S |
| Molecular Weight | 350.19 g/mol |
| Exact Mass | 348.96 |
| IUPAC Name | 4-bromo-3-[(3S)-3-hydroxypyrrolidin-1-yl]sulfonylbenzoic acid |
| SMILES | O=C(O)c1ccc(Br)c(S(=O)(=O)N2CC[C@H](O)C2)c1 |
| InChI | InChI=1S/C11H12BrNO5S/c12-9-2-1-7(11(15)16)5-10(9)19(17,18)13-4-3-8(14)6-13/h1-2,5,8,14H,3-4,6H2,(H,15,16)/t8-/m0/s1 |
| InChIKey | PKMISPHLVGXCHG-QMMMGPOBSA-N |
| XLogP | 0.90 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.19 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |