C19H23ClN4O — CID 9489639
[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[1-(4-chlorophenyl)-5-methyl-1,2,4-triazol-3-yl]methanone (PubChem CID 9489639) has the molecular formula C19H23ClN4O and a molecular weight of 358.87 g/mol. Its IUPAC name is [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[1-(4-chlorophenyl)-5-methyl-1,2,4-triazol-3-yl]methanone.
| Compound Name | [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[1-(4-chlorophenyl)-5-methyl-1,2,4-triazol-3-yl]methanone |
|---|---|
| PubChem CID | 9489639 |
| Molecular Formula | C19H23ClN4O |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[1-(4-chlorophenyl)-5-methyl-1,2,4-triazol-3-yl]methanone |
| SMILES | Cc1nc(C(=O)N2CCC[C@@H]3CCCC[C@@H]32)nn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H23ClN4O/c1-13-21-18(22-24(13)16-10-8-15(20)9-11-16)19(25)23-12-4-6-14-5-2-3-7-17(14)23/h8-11,14,17H,2-7,12H2,1H3/t14-,17-/m0/s1 |
| InChIKey | RYEOMHRMMWAWCY-YOEHRIQHSA-N |
| XLogP | 4.02 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |