C17H23NO4 — CID 94897706
methyl 2-[(1S)-6,7-dimethoxy-2-prop-2-enyl-3,4-dihydro-1H-isoquinolin-1-yl]acetate (PubChem CID 94897706) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is methyl 2-[(1S)-6,7-dimethoxy-2-prop-2-enyl-3,4-dihydro-1H-isoquinolin-1-yl]acetate.
| Compound Name | methyl 2-[(1S)-6,7-dimethoxy-2-prop-2-enyl-3,4-dihydro-1H-isoquinolin-1-yl]acetate |
|---|---|
| PubChem CID | 94897706 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | methyl 2-[(1S)-6,7-dimethoxy-2-prop-2-enyl-3,4-dihydro-1H-isoquinolin-1-yl]acetate |
| SMILES | C=CCN1CCc2cc(OC)c(OC)cc2[C@@H]1CC(=O)OC |
| InChI | InChI=1S/C17H23NO4/c1-5-7-18-8-6-12-9-15(20-2)16(21-3)10-13(12)14(18)11-17(19)22-4/h5,9-10,14H,1,6-8,11H2,2-4H3/t14-/m0/s1 |
| InChIKey | KGXFMLPDQUAYDA-AWEZNQCLSA-N |
| XLogP | 2.35 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|