C16H19N3O2S — CID 9489889
6-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 9489889) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is 6-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 6-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 9489889 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 6-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | O=C(c1cnc2sccn2c1=O)N1CC[C@H]2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C16H19N3O2S/c20-14(13-9-17-16-19(15(13)21)7-8-22-16)18-6-5-11-3-1-2-4-12(11)10-18/h7-9,11-12H,1-6,10H2/t11-,12-/m1/s1 |
| InChIKey | TUNRWYOWHQJYMO-VXGBXAGGSA-N |
| XLogP | 2.41 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |