C18H22N2OS2 — CID 9489977
[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(4-methyl-2-thiophen-2-yl-1,3-thiazol-5-yl)methanone (PubChem CID 9489977) has the molecular formula C18H22N2OS2 and a molecular weight of 346.52 g/mol. Its IUPAC name is [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(4-methyl-2-thiophen-2-yl-1,3-thiazol-5-yl)methanone.
| Compound Name | [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(4-methyl-2-thiophen-2-yl-1,3-thiazol-5-yl)methanone |
|---|---|
| PubChem CID | 9489977 |
| Molecular Formula | C18H22N2OS2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(4-methyl-2-thiophen-2-yl-1,3-thiazol-5-yl)methanone |
| SMILES | Cc1nc(-c2cccs2)sc1C(=O)N1CC[C@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C18H22N2OS2/c1-12-16(23-17(19-12)15-7-4-10-22-15)18(21)20-9-8-13-5-2-3-6-14(13)11-20/h4,7,10,13-14H,2-3,5-6,8-9,11H2,1H3/t13-,14+/m1/s1 |
| InChIKey | ZAOSWVKMDRKGAW-KGLIPLIRSA-N |
| XLogP | 4.83 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |