About 2-(2-anilino-4-methyl-1,3-thiazol-3-ium-3-yl)ethanol
2-(2-anilino-4-methyl-1,3-thiazol-3-ium-3-yl)ethanol (PubChem CID 949020) has the molecular formula C12H15N2OS+
and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-(2-anilino-4-methyl-1,3-thiazol-3-ium-3-yl)ethanol.
Molecular Properties
| Compound Name | 2-(2-anilino-4-methyl-1,3-thiazol-3-ium-3-yl)ethanol |
| PubChem CID | 949020 |
| Molecular Formula | C12H15N2OS+ |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 2-(2-anilino-4-methyl-1,3-thiazol-3-ium-3-yl)ethanol |
| SMILES | Cc1csc(Nc2ccccc2)[n+]1CCO |
| InChI | InChI=1S/C12H14N2OS/c1-10-9-16-12(14(10)7-8-15)13-11-5-3-2-4-6-11/h2-6,9,15H,7-8H2,1H3/p+1 |
| InChIKey | LOXFKQXUZQDMGR-UHFFFAOYSA-O |
| XLogP | 2.08 |
| TPSA | 36.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-anilino-4-methyl-1,3-thiazol-3-ium-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-anilino-4-methyl-1,3-thiazol-3-ium-3-yl)ethanol?
The IUPAC name of 2-(2-anilino-4-methyl-1,3-thiazol-3-ium-3-yl)ethanol (CID 949020) is 2-(2-anilino-4-methyl-1,3-thiazol-3-ium-3-yl)ethanol.
What is the SMILES notation for 2-(2-anilino-4-methyl-1,3-thiazol-3-ium-3-yl)ethanol?
The canonical SMILES for 2-(2-anilino-4-methyl-1,3-thiazol-3-ium-3-yl)ethanol is Cc1csc(Nc2ccccc2)[n+]1CCO.
What is the InChIKey of 2-(2-anilino-4-methyl-1,3-thiazol-3-ium-3-yl)ethanol?
The InChIKey is LOXFKQXUZQDMGR-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H14N2OS/c1-10-9-16-12(14(10)7-8-15)13-11-5-3-2-4-6-11/h2-6,9,15H,7-8H2,1H3/p+1.
What are the key properties of 2-(2-anilino-4-methyl-1,3-thiazol-3-ium-3-yl)ethanol?
2-(2-anilino-4-methyl-1,3-thiazol-3-ium-3-yl)ethanol has a molecular weight of 235.33 g/mol, XLogP of 2.08, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-anilino-4-methyl-1,3-thiazol-3-ium-3-yl)ethanol is sourced from PubChem (CID 949020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).