C15H16FN3O3S — CID 9490208
2-(2,4-dioxopyrimidin-1-yl)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]acetamide (PubChem CID 9490208) has the molecular formula C15H16FN3O3S and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-(2,4-dioxopyrimidin-1-yl)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]acetamide.
| Compound Name | 2-(2,4-dioxopyrimidin-1-yl)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 9490208 |
| Molecular Formula | C15H16FN3O3S |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 2-(2,4-dioxopyrimidin-1-yl)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]acetamide |
| SMILES | O=C(Cn1ccc(=O)[nH]c1=O)NCCSCc1ccccc1F |
| InChI | InChI=1S/C15H16FN3O3S/c16-12-4-2-1-3-11(12)10-23-8-6-17-14(21)9-19-7-5-13(20)18-15(19)22/h1-5,7H,6,8-10H2,(H,17,21)(H,18,20,22) |
| InChIKey | PHMAGZWRLVMTIF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|