C17H20N4O3 — CID 949127
ethyl 2-[(4S)-6-amino-5-cyano-4-[(1S)-cyclohex-2-en-1-yl]-2,4-dihydropyrano[2,3-c]pyrazol-3-yl]acetate (PubChem CID 949127) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is ethyl 2-[(4S)-6-amino-5-cyano-4-[(1S)-cyclohex-2-en-1-yl]-2,4-dihydropyrano[2,3-c]pyrazol-3-yl]acetate.
| Compound Name | ethyl 2-[(4S)-6-amino-5-cyano-4-[(1S)-cyclohex-2-en-1-yl]-2,4-dihydropyrano[2,3-c]pyrazol-3-yl]acetate |
|---|---|
| PubChem CID | 949127 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | ethyl 2-[(4S)-6-amino-5-cyano-4-[(1S)-cyclohex-2-en-1-yl]-2,4-dihydropyrano[2,3-c]pyrazol-3-yl]acetate |
| SMILES | CCOC(=O)Cc1[nH]nc2c1[C@@H]([C@@H]1C=CCCC1)C(C#N)=C(N)O2 |
| InChI | InChI=1S/C17H20N4O3/c1-2-23-13(22)8-12-15-14(10-6-4-3-5-7-10)11(9-18)16(19)24-17(15)21-20-12/h4,6,10,14H,2-3,5,7-8,19H2,1H3,(H,20,21)/t10-,14+/m1/s1 |
| InChIKey | HLCSEJKHTHKPSZ-YGRLFVJLSA-N |
| XLogP | 2.04 |
| TPSA | 114.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|