C15H16N2O6S — CID 94919629
N-(3,4-dimethoxyphenyl)-N-methyl-3-nitrobenzenesulfonamide (PubChem CID 94919629) has the molecular formula C15H16N2O6S and a molecular weight of 352.37 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-N-methyl-3-nitrobenzenesulfonamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-N-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 94919629 |
| Molecular Formula | C15H16N2O6S |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-N-methyl-3-nitrobenzenesulfonamide |
| SMILES | COc1ccc(N(C)S(=O)(=O)c2cccc([N+](=O)[O-])c2)cc1OC |
| InChI | InChI=1S/C15H16N2O6S/c1-16(11-7-8-14(22-2)15(10-11)23-3)24(20,21)13-6-4-5-12(9-13)17(18)19/h4-10H,1-3H3 |
| InChIKey | PRRCVKHYUPXURL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|