About 2-[[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]amino]-N-propan-2-ylacetamide
2-[[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]amino]-N-propan-2-ylacetamide (PubChem CID 9492221) has the molecular formula C11H14Cl2N4O3
and a molecular weight of 321.16 g/mol. Its IUPAC name is 2-[[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]amino]-N-propan-2-ylacetamide.
Molecular Properties
| Compound Name | 2-[[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]amino]-N-propan-2-ylacetamide |
| PubChem CID | 9492221 |
| Molecular Formula | C11H14Cl2N4O3 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 2-[[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]amino]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CNC(=O)Cn1ncc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C11H14Cl2N4O3/c1-6(2)16-8(18)4-14-9(19)5-17-11(20)10(13)7(12)3-15-17/h3,6H,4-5H2,1-2H3,(H,14,19)(H,16,18) |
| InChIKey | NQTLAERCAMHFIP-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]amino]-N-propan-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]amino]-N-propan-2-ylacetamide?
The IUPAC name of 2-[[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]amino]-N-propan-2-ylacetamide (CID 9492221) is 2-[[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]amino]-N-propan-2-ylacetamide.
What is the SMILES notation for 2-[[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]amino]-N-propan-2-ylacetamide?
The canonical SMILES for 2-[[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]amino]-N-propan-2-ylacetamide is CC(C)NC(=O)CNC(=O)Cn1ncc(Cl)c(Cl)c1=O.
What is the InChIKey of 2-[[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]amino]-N-propan-2-ylacetamide?
The InChIKey is NQTLAERCAMHFIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14Cl2N4O3/c1-6(2)16-8(18)4-14-9(19)5-17-11(20)10(13)7(12)3-15-17/h3,6H,4-5H2,1-2H3,(H,14,19)(H,16,18).
What are the key properties of 2-[[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]amino]-N-propan-2-ylacetamide?
2-[[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]amino]-N-propan-2-ylacetamide has a molecular weight of 321.16 g/mol, XLogP of 0.19, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]amino]-N-propan-2-ylacetamide is sourced from PubChem (CID 9492221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).