C20H33N2O2+ — CID 949290
3-[(3aR,9aR)-5,5-dimethyl-1,3-dioxo-4,6,7,8,9,9a-hexahydro-3aH-benzo[f]isoindol-2-yl]propyl-trimethylazanium (PubChem CID 949290) has the molecular formula C20H33N2O2+ and a molecular weight of 333.50 g/mol. Its IUPAC name is 3-[(3aR,9aR)-5,5-dimethyl-1,3-dioxo-4,6,7,8,9,9a-hexahydro-3aH-benzo[f]isoindol-2-yl]propyl-trimethylazanium.
| Compound Name | 3-[(3aR,9aR)-5,5-dimethyl-1,3-dioxo-4,6,7,8,9,9a-hexahydro-3aH-benzo[f]isoindol-2-yl]propyl-trimethylazanium |
|---|---|
| PubChem CID | 949290 |
| Molecular Formula | C20H33N2O2+ |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | 3-[(3aR,9aR)-5,5-dimethyl-1,3-dioxo-4,6,7,8,9,9a-hexahydro-3aH-benzo[f]isoindol-2-yl]propyl-trimethylazanium |
| SMILES | CC1(C)CCCC2=C1C[C@H]1C(=O)N(CCC[N+](C)(C)C)C(=O)[C@@H]1C2 |
| InChI | InChI=1S/C20H33N2O2/c1-20(2)9-6-8-14-12-15-16(13-17(14)20)19(24)21(18(15)23)10-7-11-22(3,4)5/h15-16H,6-13H2,1-5H3/q+1/t15-,16-/m1/s1 |
| InChIKey | JARWJTFCBSGCBH-HZPDHXFCSA-N |
| XLogP | 2.98 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|