C15H14N4O2S — CID 94935952
2-[4-[4-(aminomethyl)-5-thiophen-2-yltriazol-1-yl]phenyl]acetic acid (PubChem CID 94935952) has the molecular formula C15H14N4O2S and a molecular weight of 314.37 g/mol. Its IUPAC name is 2-[4-[4-(aminomethyl)-5-thiophen-2-yltriazol-1-yl]phenyl]acetic acid.
| Compound Name | 2-[4-[4-(aminomethyl)-5-thiophen-2-yltriazol-1-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 94935952 |
| Molecular Formula | C15H14N4O2S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 2-[4-[4-(aminomethyl)-5-thiophen-2-yltriazol-1-yl]phenyl]acetic acid |
| SMILES | NCc1nnn(-c2ccc(CC(=O)O)cc2)c1-c1cccs1 |
| InChI | InChI=1S/C15H14N4O2S/c16-9-12-15(13-2-1-7-22-13)19(18-17-12)11-5-3-10(4-6-11)8-14(20)21/h1-7H,8-9,16H2,(H,20,21) |
| InChIKey | HIJXXDKCWFRIIZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |