C18H19N3O2 — CID 94936961
[1-(3,4-dimethylphenyl)-5-(phenoxymethyl)triazol-4-yl]methanol (PubChem CID 94936961) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is [1-(3,4-dimethylphenyl)-5-(phenoxymethyl)triazol-4-yl]methanol.
| Compound Name | [1-(3,4-dimethylphenyl)-5-(phenoxymethyl)triazol-4-yl]methanol |
|---|---|
| PubChem CID | 94936961 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | [1-(3,4-dimethylphenyl)-5-(phenoxymethyl)triazol-4-yl]methanol |
| SMILES | Cc1ccc(-n2nnc(CO)c2COc2ccccc2)cc1C |
| InChI | InChI=1S/C18H19N3O2/c1-13-8-9-15(10-14(13)2)21-18(17(11-22)19-20-21)12-23-16-6-4-3-5-7-16/h3-10,22H,11-12H2,1-2H3 |
| InChIKey | QLJGIXPELUMTIR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |