C23H31N3O3S — CID 9493876
(2R)-1-(azepan-1-yl)-2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)propan-1-one (PubChem CID 9493876) has the molecular formula C23H31N3O3S and a molecular weight of 429.59 g/mol. Its IUPAC name is (2R)-1-(azepan-1-yl)-2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)propan-1-one.
| Compound Name | (2R)-1-(azepan-1-yl)-2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 9493876 |
| Molecular Formula | C23H31N3O3S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | (2R)-1-(azepan-1-yl)-2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)propan-1-one |
| SMILES | C[C@H](C(=O)N1CCCCCC1)N1CCN(S(=O)(=O)c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C23H31N3O3S/c1-19(23(27)25-12-6-2-3-7-13-25)24-14-16-26(17-15-24)30(28,29)22-11-10-20-8-4-5-9-21(20)18-22/h4-5,8-11,18-19H,2-3,6-7,12-17H2,1H3/t19-/m1/s1 |
| InChIKey | IRIUYGKIDWGNPF-LJQANCHMSA-N |
| XLogP | 2.94 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |