C16H19N3O4 — CID 94940288
5-cyclopropyl-1-(3,4-diethoxyphenyl)triazole-4-carboxylic acid (PubChem CID 94940288) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is 5-cyclopropyl-1-(3,4-diethoxyphenyl)triazole-4-carboxylic acid.
| Compound Name | 5-cyclopropyl-1-(3,4-diethoxyphenyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 94940288 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 5-cyclopropyl-1-(3,4-diethoxyphenyl)triazole-4-carboxylic acid |
| SMILES | CCOc1ccc(-n2nnc(C(=O)O)c2C2CC2)cc1OCC |
| InChI | InChI=1S/C16H19N3O4/c1-3-22-12-8-7-11(9-13(12)23-4-2)19-15(10-5-6-10)14(16(20)21)17-18-19/h7-10H,3-6H2,1-2H3,(H,20,21) |
| InChIKey | XNGLXZCIRLUHPT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |