C17H14N6O — CID 94943137
3-benzyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)triazol-4-amine (PubChem CID 94943137) has the molecular formula C17H14N6O and a molecular weight of 318.34 g/mol. Its IUPAC name is 3-benzyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)triazol-4-amine.
| Compound Name | 3-benzyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)triazol-4-amine |
|---|---|
| PubChem CID | 94943137 |
| Molecular Formula | C17H14N6O |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 3-benzyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)triazol-4-amine |
| SMILES | Nc1c(-c2nc(-c3ccccc3)no2)nnn1Cc1ccccc1 |
| InChI | InChI=1S/C17H14N6O/c18-15-14(20-22-23(15)11-12-7-3-1-4-8-12)17-19-16(21-24-17)13-9-5-2-6-10-13/h1-10H,11,18H2 |
| InChIKey | XBFNOCLJTJNTDP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 95.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |