C14H13Cl2N3O — CID 94943286
5-cyclobutyl-1-[(2,6-dichlorophenyl)methyl]triazole-4-carbaldehyde (PubChem CID 94943286) has the molecular formula C14H13Cl2N3O and a molecular weight of 310.18 g/mol. Its IUPAC name is 5-cyclobutyl-1-[(2,6-dichlorophenyl)methyl]triazole-4-carbaldehyde.
| Compound Name | 5-cyclobutyl-1-[(2,6-dichlorophenyl)methyl]triazole-4-carbaldehyde |
|---|---|
| PubChem CID | 94943286 |
| Molecular Formula | C14H13Cl2N3O |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 5-cyclobutyl-1-[(2,6-dichlorophenyl)methyl]triazole-4-carbaldehyde |
| SMILES | O=Cc1nnn(Cc2c(Cl)cccc2Cl)c1C1CCC1 |
| InChI | InChI=1S/C14H13Cl2N3O/c15-11-5-2-6-12(16)10(11)7-19-14(9-3-1-4-9)13(8-20)17-18-19/h2,5-6,8-9H,1,3-4,7H2 |
| InChIKey | BFJSSVXJABACKQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|