C15H12ClFN4O — CID 94943504
[1-[(2-chloro-6-fluorophenyl)methyl]-5-pyridin-3-yltriazol-4-yl]methanol (PubChem CID 94943504) has the molecular formula C15H12ClFN4O and a molecular weight of 318.74 g/mol. Its IUPAC name is [1-[(2-chloro-6-fluorophenyl)methyl]-5-pyridin-3-yltriazol-4-yl]methanol.
| Compound Name | [1-[(2-chloro-6-fluorophenyl)methyl]-5-pyridin-3-yltriazol-4-yl]methanol |
|---|---|
| PubChem CID | 94943504 |
| Molecular Formula | C15H12ClFN4O |
| Molecular Weight | 318.74 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | [1-[(2-chloro-6-fluorophenyl)methyl]-5-pyridin-3-yltriazol-4-yl]methanol |
| SMILES | OCc1nnn(Cc2c(F)cccc2Cl)c1-c1cccnc1 |
| InChI | InChI=1S/C15H12ClFN4O/c16-12-4-1-5-13(17)11(12)8-21-15(14(9-22)19-20-21)10-3-2-6-18-7-10/h1-7,22H,8-9H2 |
| InChIKey | HIVRPSODODLNEQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.74 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |