C17H23N3O3 — CID 94944762
5-[(3,4-dimethoxyphenyl)methyl]-1-(3-methylbutyl)triazole-4-carbaldehyde (PubChem CID 94944762) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 5-[(3,4-dimethoxyphenyl)methyl]-1-(3-methylbutyl)triazole-4-carbaldehyde.
| Compound Name | 5-[(3,4-dimethoxyphenyl)methyl]-1-(3-methylbutyl)triazole-4-carbaldehyde |
|---|---|
| PubChem CID | 94944762 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 5-[(3,4-dimethoxyphenyl)methyl]-1-(3-methylbutyl)triazole-4-carbaldehyde |
| SMILES | COc1ccc(Cc2c(C=O)nnn2CCC(C)C)cc1OC |
| InChI | InChI=1S/C17H23N3O3/c1-12(2)7-8-20-15(14(11-21)18-19-20)9-13-5-6-16(22-3)17(10-13)23-4/h5-6,10-12H,7-9H2,1-4H3 |
| InChIKey | REECZJOZUQMTIC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|