C18H16N2O3 — CID 94946721
2-(3-methoxyphenyl)-1-(3-methylphenyl)imidazole-4-carboxylic acid (PubChem CID 94946721) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-1-(3-methylphenyl)imidazole-4-carboxylic acid.
| Compound Name | 2-(3-methoxyphenyl)-1-(3-methylphenyl)imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 94946721 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 2-(3-methoxyphenyl)-1-(3-methylphenyl)imidazole-4-carboxylic acid |
| SMILES | COc1cccc(-c2nc(C(=O)O)cn2-c2cccc(C)c2)c1 |
| InChI | InChI=1S/C18H16N2O3/c1-12-5-3-7-14(9-12)20-11-16(18(21)22)19-17(20)13-6-4-8-15(10-13)23-2/h3-11H,1-2H3,(H,21,22) |
| InChIKey | DPKGVWVIHJGPCE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |