C18H29N3O4 — CID 9494705
(2S)-2-[(4-ethoxy-3-methoxyphenyl)methyl-methylamino]-N-(propan-2-ylcarbamoyl)propanamide (PubChem CID 9494705) has the molecular formula C18H29N3O4 and a molecular weight of 351.45 g/mol. Its IUPAC name is (2S)-2-[(4-ethoxy-3-methoxyphenyl)methyl-methylamino]-N-(propan-2-ylcarbamoyl)propanamide.
| Compound Name | (2S)-2-[(4-ethoxy-3-methoxyphenyl)methyl-methylamino]-N-(propan-2-ylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 9494705 |
| Molecular Formula | C18H29N3O4 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | (2S)-2-[(4-ethoxy-3-methoxyphenyl)methyl-methylamino]-N-(propan-2-ylcarbamoyl)propanamide |
| SMILES | CCOc1ccc(CN(C)[C@@H](C)C(=O)NC(=O)NC(C)C)cc1OC |
| InChI | InChI=1S/C18H29N3O4/c1-7-25-15-9-8-14(10-16(15)24-6)11-21(5)13(4)17(22)20-18(23)19-12(2)3/h8-10,12-13H,7,11H2,1-6H3,(H2,19,20,22,23)/t13-/m0/s1 |
| InChIKey | YVLWDCRZETWWJC-ZDUSSCGKSA-N |
| XLogP | 2.15 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |