C16H16N4O3 — CID 94947357
5-amino-1-ethyl-N-(5-methyl-1,2-oxazol-3-yl)-4-oxoquinoline-3-carboxamide (PubChem CID 94947357) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is 5-amino-1-ethyl-N-(5-methyl-1,2-oxazol-3-yl)-4-oxoquinoline-3-carboxamide.
| Compound Name | 5-amino-1-ethyl-N-(5-methyl-1,2-oxazol-3-yl)-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 94947357 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 5-amino-1-ethyl-N-(5-methyl-1,2-oxazol-3-yl)-4-oxoquinoline-3-carboxamide |
| SMILES | CCn1cc(C(=O)Nc2cc(C)on2)c(=O)c2c(N)cccc21 |
| InChI | InChI=1S/C16H16N4O3/c1-3-20-8-10(16(22)18-13-7-9(2)23-19-13)15(21)14-11(17)5-4-6-12(14)20/h4-8H,3,17H2,1-2H3,(H,18,19,22) |
| InChIKey | MEKDOZDDWGGOPR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 103.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|