C17H22N2O4 — CID 94958935
1-benzyl-3-hydroxy-2-[[2-hydroxyethyl(methyl)amino]methyl]-6-(hydroxymethyl)pyridin-4-one (PubChem CID 94958935) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is 1-benzyl-3-hydroxy-2-[[2-hydroxyethyl(methyl)amino]methyl]-6-(hydroxymethyl)pyridin-4-one.
| Compound Name | 1-benzyl-3-hydroxy-2-[[2-hydroxyethyl(methyl)amino]methyl]-6-(hydroxymethyl)pyridin-4-one |
|---|---|
| PubChem CID | 94958935 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 1-benzyl-3-hydroxy-2-[[2-hydroxyethyl(methyl)amino]methyl]-6-(hydroxymethyl)pyridin-4-one |
| SMILES | CN(CCO)Cc1c(O)c(=O)cc(CO)n1Cc1ccccc1 |
| InChI | InChI=1S/C17H22N2O4/c1-18(7-8-20)11-15-17(23)16(22)9-14(12-21)19(15)10-13-5-3-2-4-6-13/h2-6,9,20-21,23H,7-8,10-12H2,1H3 |
| InChIKey | ITTWUBDTZNJZJW-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 85.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |