C16H9Cl2N3 — CID 94962068
1,5-bis(4-chlorophenyl)pyrazole-3-carbonitrile (PubChem CID 94962068) has the molecular formula C16H9Cl2N3 and a molecular weight of 314.18 g/mol. Its IUPAC name is 1,5-bis(4-chlorophenyl)pyrazole-3-carbonitrile.
| Compound Name | 1,5-bis(4-chlorophenyl)pyrazole-3-carbonitrile |
|---|---|
| PubChem CID | 94962068 |
| Molecular Formula | C16H9Cl2N3 |
| Molecular Weight | 314.18 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 1,5-bis(4-chlorophenyl)pyrazole-3-carbonitrile |
| SMILES | N#Cc1cc(-c2ccc(Cl)cc2)n(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C16H9Cl2N3/c17-12-3-1-11(2-4-12)16-9-14(10-19)20-21(16)15-7-5-13(18)6-8-15/h1-9H |
| InChIKey | AJINDNUMHCOKPT-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.18 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |